Zoisite is one of the Shittenou in Pretty Guardian Sailor Moon.
| Attributes | Values |
|---|
| rdf:type
| |
| rdfs:label
| - Zoisite
- Zoisite
- Zoisite
- Zoisite
|
| rdfs:comment
| - Zoisite (jap. ゾイサイト Zoisaito) – trzeci z czterech generałów Królowej Beryl, miał wygląd młodego mężczyzny o długich złocistobrązowych włosach i zielonych oczach. Takeuchi opisuje go jako najmniej dojrzałego i najbardziej zniewieściałego z czterech Shitenō. Jego zadaniem było zdobyć Srebrny Kryształ. Aby tego dokonać, używa Czarnego Kryształu (ukradzionego wcześniej umierającemu Nephrite) do wykrywania Tęczowych Kryształów. Jest zakochany w generale Kunzite.
- Zoisite is one of the Shittenou in Pretty Guardian Sailor Moon.
- Zoisite ist einer der Vier Generäle und kämpft unter dem Einfluss von Königin Periglia für das Königreich des Dunklen. Er ist der Repräsentant Europas. Ursprünglich gehörte er zur Leibgarde Prinz Endymions.
- Description The stone changes from deep purple to black and has mesmeric power. Some believe that all darkness was banished into this crystal. This stone is material for dragon-slaying potions.
* Tower II
* 5 Zoisite Fragment
* Zoisite Bracelet
* Zoisite Ring
* Zoisite Staff
* Zoisite Necklace
* Fossilizing Book
* Absorbing Wand
* Adds 1 Zoisite Magic Point
- Zoisite is the third of the Shitennou to appear. Zoisite is the commander of the Dark Kingdom's European division, as he states in Act 6. He is about the same height as Jadeite, and his estimated age is 16-17 according to the Materials Collection.
- Zoisite is a calcium aluminium hydroxy sorosilicate belonging to the epidote group of minerals. Its chemical formula is Ca2Al3(SiO4)(Si2O7)O(OH). Zoisite is named after the Slovene scientist Baron Sigmund Zois von Edelstein (Žiga Zois), who realized that this was an unknown mineral when it was brought to him by the mineral dealer Simon Prešern, who had discovered it in the Saualpe mountains (Svinška planina) of Carinthia in 1805. Zoisite was first known as saualpite, after its type locality. Transparent material is fashioned into gemstones while translucent-to-opaque material is usually carved into sculptural works. The latter is sometimes shot through with ruby crystals, which are completely opaque and unsuited to use as gems, yet are well colored and contrast strikingly against the green
|
| sameAs
| |
| var2text
| |
| Alignment
| |
| dcterms:subject
| |
| przynależność
| |
| dbkwik:resource/3aEoHpm8O2FIoGGin8H6Pg==
| |
| Płeć
| |
| dbkwik:resource/5jNhMN_1zNku78kf9Fp2Lg==
| |
| dbkwik:resource/7IwcdSZLKJAdNIXwSmH9Ig==
| |
| dbkwik:resource/EBKe0LaNBvhaYdqOrZBTKw==
| |
| Seiyū
| |
| Imię
| |
| Gatunek
| |
| dbkwik:resource/PVshM8egGO1z4PyrJ_-t1g==
| - Commander of the European Division
- Rycerz Oczyszczenia i Uzdrowienia
|
| obrazek
| |
| dbkwik:resource/e860DyZeX1grLf4GsxMTKQ==
| |
| dbkwik:resource/llnS-cYmDw3CZerpK3y8VQ==
| |
| kanji / kana
| |
| related pages
| |
| dbkwik:resource/wjvZvEfbjBmcTLdsu6Fn8g==
| |
| dbkwik:ceramica/pr...iPageUsesTemplate
| |
| dbkwik:tokusatsu/p...iPageUsesTemplate
| |
| Category
| |
| opticalprop
| |
| Associates
| - Queen Beryl, the other Shitennou, Prince Endymion
|
| Cast
| |
| Age
| |
| mohs
| |
| First Appearance
| |
| Gravity
| |
| Name
| |
| Type
| |
| Caption
| |
| var1text
| - Gem-quality zoisite, blue-purple
|
| dbkwik:resource/2-_PyxRRvylksHLd5vrErA==
| - Profesor Izono ; Saitō Izō, Uczeń Liceum B
|
| dbkwik:sailormoon/...iPageUsesTemplate
| |
| Aliases
| |
| streak
| |
| Species
| |
| Titles
| - Commander of the European Division)
|
| formula
| |